C21H14F3N3O — CID 91526075
2-[4-[4-(4-deuteriophenyl)buta-1,3-dienyl]-3-isocyano-5-methyl-5-(2,2,2-trifluoroethyl)furan-2-ylidene]-2-isocyanoacetonitrile (PubChem CID 91526075) has the molecular formula C21H14F3N3O and a molecular weight of 382.36 g/mol. Its IUPAC name is 2-[4-[4-(4-deuteriophenyl)buta-1,3-dienyl]-3-isocyano-5-methyl-5-(2,2,2-trifluoroethyl)furan-2-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[4-[4-(4-deuteriophenyl)buta-1,3-dienyl]-3-isocyano-5-methyl-5-(2,2,2-trifluoroethyl)furan-2-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 91526075 |
| Molecular Formula | C21H14F3N3O |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[4-[4-(4-deuteriophenyl)buta-1,3-dienyl]-3-isocyano-5-methyl-5-(2,2,2-trifluoroethyl)furan-2-ylidene]-2-isocyanoacetonitrile |
| SMILES | [2H]c1ccc(C=CC=CC2=C([N+]#[C-])C(=C(C#N)[N+]#[C-])OC2(C)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H14F3N3O/c1-20(14-21(22,23)24)16(12-8-7-11-15-9-5-4-6-10-15)18(27-3)19(28-20)17(13-25)26-2/h4-12H,14H2,1H3/i4D |
| InChIKey | BDUYMECLTZDGSR-QYKNYGDISA-N |
| XLogP | 5.83 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|