About 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole
5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole (PubChem CID 91526496) has the molecular formula C12H17NO2S
and a molecular weight of 239.34 g/mol. Its IUPAC name is 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole.
Molecular Properties
| Compound Name | 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole |
| PubChem CID | 91526496 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole |
| SMILES | Cc1cc(C2CCC3(CC2)OCCO3)sn1 |
| InChI | InChI=1S/C12H17NO2S/c1-9-8-11(16-13-9)10-2-4-12(5-3-10)14-6-7-15-12/h8,10H,2-7H2,1H3 |
| InChIKey | ZVFOZHMTMRWSHT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole?
The IUPAC name of 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole (CID 91526496) is 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole.
What is the SMILES notation for 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole?
The canonical SMILES for 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole is Cc1cc(C2CCC3(CC2)OCCO3)sn1.
What is the InChIKey of 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole?
The InChIKey is ZVFOZHMTMRWSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2S/c1-9-8-11(16-13-9)10-2-4-12(5-3-10)14-6-7-15-12/h8,10H,2-7H2,1H3.
What are the key properties of 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole?
5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole has a molecular weight of 239.34 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4-dioxaspiro[4.5]decan-8-yl)-3-methyl-1,2-thiazole is sourced from PubChem (CID 91526496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).