About (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine
(E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine (PubChem CID 91527004) has the molecular formula C9H13F3N2
and a molecular weight of 206.21 g/mol. Its IUPAC name is (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine.
Molecular Properties
| Compound Name | (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine |
| PubChem CID | 91527004 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine |
| SMILES | C/C=C\C(=N\C=C\C(C)N)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2/c1-3-4-8(9(10,11)12)14-6-5-7(2)13/h3-7H,13H2,1-2H3/b4-3-,6-5+,14-8- |
| InChIKey | DMZXUUYNMZCYJU-PQNSOYIDSA-N |
| XLogP | 2.43 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine?
The IUPAC name of (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine (CID 91527004) is (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine.
What is the SMILES notation for (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine?
The canonical SMILES for (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine is C/C=C\C(=N\C=C\C(C)N)C(F)(F)F.
What is the InChIKey of (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine?
The InChIKey is DMZXUUYNMZCYJU-PQNSOYIDSA-N. The full InChI is InChI=1S/C9H13F3N2/c1-3-4-8(9(10,11)12)14-6-5-7(2)13/h3-7H,13H2,1-2H3/b4-3-,6-5+,14-8-.
What are the key properties of (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine?
(E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine has a molecular weight of 206.21 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[[(Z)-1,1,1-trifluoropent-3-en-2-ylidene]amino]but-3-en-2-amine is sourced from PubChem (CID 91527004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).