C12H20F2O9 — CID 91527553
(2S,3S,4S,5R,6R)-2-(fluoromethyl)-6-[(2S,3S,4R,5R,6S)-2-(fluoromethyl)-4,5,6-trihydroxyoxan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 91527553) has the molecular formula C12H20F2O9 and a molecular weight of 346.28 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-(fluoromethyl)-6-[(2S,3S,4R,5R,6S)-2-(fluoromethyl)-4,5,6-trihydroxyoxan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5R,6R)-2-(fluoromethyl)-6-[(2S,3S,4R,5R,6S)-2-(fluoromethyl)-4,5,6-trihydroxyoxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 91527553 |
| Molecular Formula | C12H20F2O9 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-(fluoromethyl)-6-[(2S,3S,4R,5R,6S)-2-(fluoromethyl)-4,5,6-trihydroxyoxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]2CF)O[C@H](CF)[C@H]1O |
| InChI | InChI=1S/C12H20F2O9/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-12,15-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12+/m1/s1 |
| InChIKey | NPMOOOXYDAPPPU-MFRLZQSSSA-N |
| XLogP | -3.44 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |