C33H50N2O7 — CID 91527624
[(2R,10R,11R,14R)-11,14-dihydroxy-4-methyl-2-[(2S)-4-methyl-6-(3-methylbut-2-enoylamino)hexa-3,5-dien-2-yl]-20-oxo-1-oxacycloicosa-4,6,18-trien-10-yl] carbamate (PubChem CID 91527624) has the molecular formula C33H50N2O7 and a molecular weight of 586.77 g/mol. Its IUPAC name is [(2R,10R,11R,14R)-11,14-dihydroxy-4-methyl-2-[(2S)-4-methyl-6-(3-methylbut-2-enoylamino)hexa-3,5-dien-2-yl]-20-oxo-1-oxacycloicosa-4,6,18-trien-10-yl] carbamate.
| Compound Name | [(2R,10R,11R,14R)-11,14-dihydroxy-4-methyl-2-[(2S)-4-methyl-6-(3-methylbut-2-enoylamino)hexa-3,5-dien-2-yl]-20-oxo-1-oxacycloicosa-4,6,18-trien-10-yl] carbamate |
|---|---|
| PubChem CID | 91527624 |
| Molecular Formula | C33H50N2O7 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.36 |
| IUPAC Name | [(2R,10R,11R,14R)-11,14-dihydroxy-4-methyl-2-[(2S)-4-methyl-6-(3-methylbut-2-enoylamino)hexa-3,5-dien-2-yl]-20-oxo-1-oxacycloicosa-4,6,18-trien-10-yl] carbamate |
| SMILES | CC(C)=CC(=O)NC=CC(C)=C[C@H](C)[C@H]1CC(C)=CC=CCC[C@@H](OC(N)=O)[C@H](O)CC[C@H](O)CCCC=CC(=O)O1 |
| InChI | InChI=1S/C33H50N2O7/c1-23(2)20-31(38)35-19-18-25(4)21-26(5)30-22-24(3)12-8-6-10-14-29(42-33(34)40)28(37)17-16-27(36)13-9-7-11-15-32(39)41-30/h6,8,11-12,15,18-21,26-30,36-37H,7,9-10,13-14,16-17,22H2,1-5H3,(H2,34,40)(H,35,38)/t26-,27+,28+,29+,30+/m0/s1 |
| InChIKey | CYALQACMUTZLHK-XOZXEBRTSA-N |
| XLogP | 5.46 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|