C39H46N6O6 — CID 91527822
ethyl (1R,4S,14S)-4-[2-[2-(1-benzylpyrazol-4-yl)-7-methoxy-8-methylquinolin-4-yl]oxyethyl]-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylate (PubChem CID 91527822) has the molecular formula C39H46N6O6 and a molecular weight of 694.83 g/mol. Its IUPAC name is ethyl (1R,4S,14S)-4-[2-[2-(1-benzylpyrazol-4-yl)-7-methoxy-8-methylquinolin-4-yl]oxyethyl]-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylate.
| Compound Name | ethyl (1R,4S,14S)-4-[2-[2-(1-benzylpyrazol-4-yl)-7-methoxy-8-methylquinolin-4-yl]oxyethyl]-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylate |
|---|---|
| PubChem CID | 91527822 |
| Molecular Formula | C39H46N6O6 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.35 |
| IUPAC Name | ethyl (1R,4S,14S)-4-[2-[2-(1-benzylpyrazol-4-yl)-7-methoxy-8-methylquinolin-4-yl]oxyethyl]-7-methyl-3,6-dioxo-2,5,7-triazabicyclo[12.1.0]pentadec-12-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1C=CCCCCN(C)C(=O)N[C@@H](CCOc1cc(-c3cnn(Cc4ccccc4)c3)nc3c(C)c(OC)ccc13)C(=O)N2 |
| InChI | InChI=1S/C39H46N6O6/c1-5-50-37(47)39-22-29(39)15-11-6-7-12-19-44(3)38(48)42-31(36(46)43-39)18-20-51-34-21-32(41-35-26(2)33(49-4)17-16-30(34)35)28-23-40-45(25-28)24-27-13-9-8-10-14-27/h8-11,13-17,21,23,25,29,31H,5-7,12,18-20,22,24H2,1-4H3,(H,42,48)(H,43,46)/t29-,31+,39-/m1/s1 |
| InChIKey | SICHUZUYSKYAMY-JWWDCXKFSA-N |
| XLogP | 5.42 |
| TPSA | 136.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|