C20H29ClN2O3 — CID 91527951
tert-butyl N-[3-(5-chloro-2-cyanophenoxy)heptyl]-N-methylcarbamate (PubChem CID 91527951) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is tert-butyl N-[3-(5-chloro-2-cyanophenoxy)heptyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-(5-chloro-2-cyanophenoxy)heptyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 91527951 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | tert-butyl N-[3-(5-chloro-2-cyanophenoxy)heptyl]-N-methylcarbamate |
| SMILES | CCCCC(CCN(C)C(=O)OC(C)(C)C)Oc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C20H29ClN2O3/c1-6-7-8-17(11-12-23(5)19(24)26-20(2,3)4)25-18-13-16(21)10-9-15(18)14-22/h9-10,13,17H,6-8,11-12H2,1-5H3 |
| InChIKey | YEEXGBDBZVDGFH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |