C7H9N3 — CID 91527987
6,9-dihydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 91527987) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 6,9-dihydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 6,9-dihydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 91527987 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 6,9-dihydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | C1=CCc2nncn2CC1 |
| InChI | InChI=1S/C7H9N3/c1-2-4-7-9-8-6-10(7)5-3-1/h1-2,6H,3-5H2 |
| InChIKey | MEUPFNYFCRQDMK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|