C20H22N2O8 — CID 91528230
N-acetyl-N-methylacetamide;methyl (6aS)-5-benzyl-2,4,6-trioxo-3,6a-dihydrofuro[2,3-c]pyrrole-3a-carboxylate (PubChem CID 91528230) has the molecular formula C20H22N2O8 and a molecular weight of 418.40 g/mol. Its IUPAC name is N-acetyl-N-methylacetamide;methyl (6aS)-5-benzyl-2,4,6-trioxo-3,6a-dihydrofuro[2,3-c]pyrrole-3a-carboxylate.
| Compound Name | N-acetyl-N-methylacetamide;methyl (6aS)-5-benzyl-2,4,6-trioxo-3,6a-dihydrofuro[2,3-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 91528230 |
| Molecular Formula | C20H22N2O8 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-acetyl-N-methylacetamide;methyl (6aS)-5-benzyl-2,4,6-trioxo-3,6a-dihydrofuro[2,3-c]pyrrole-3a-carboxylate |
| SMILES | CC(=O)N(C)C(C)=O.COC(=O)C12CC(=O)O[C@@H]1C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C15H13NO6.C5H9NO2/c1-21-14(20)15-7-10(17)22-11(15)12(18)16(13(15)19)8-9-5-3-2-4-6-9;1-4(7)6(3)5(2)8/h2-6,11H,7-8H2,1H3;1-3H3/t11-,15?;/m1./s1 |
| InChIKey | UKBKDWREFVWBQT-IXCAENJASA-N |
| XLogP | 0.04 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|