C18H32 — CID 91528395
4-ethyl-3-methyl-5-(2,3,3-trimethylbutan-2-yl)octa-2,4,6-triene (PubChem CID 91528395) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is 4-ethyl-3-methyl-5-(2,3,3-trimethylbutan-2-yl)octa-2,4,6-triene.
| Compound Name | 4-ethyl-3-methyl-5-(2,3,3-trimethylbutan-2-yl)octa-2,4,6-triene |
|---|---|
| PubChem CID | 91528395 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 4-ethyl-3-methyl-5-(2,3,3-trimethylbutan-2-yl)octa-2,4,6-triene |
| SMILES | CC=CC(=C(CC)C(C)=CC)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32/c1-10-13-16(15(12-3)14(4)11-2)18(8,9)17(5,6)7/h10-11,13H,12H2,1-9H3 |
| InChIKey | ZBCCLIUTOVGOBC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|