C12H28N2O2 — CID 91528509
1,4-bis(diethylamino)butane-1,3-diol (PubChem CID 91528509) has the molecular formula C12H28N2O2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1,4-bis(diethylamino)butane-1,3-diol.
| Compound Name | 1,4-bis(diethylamino)butane-1,3-diol |
|---|---|
| PubChem CID | 91528509 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1,4-bis(diethylamino)butane-1,3-diol |
| SMILES | CCN(CC)CC(O)CC(O)N(CC)CC |
| InChI | InChI=1S/C12H28N2O2/c1-5-13(6-2)10-11(15)9-12(16)14(7-3)8-4/h11-12,15-16H,5-10H2,1-4H3 |
| InChIKey | FVTVXBGHYZPWAJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|