About S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate
S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate (PubChem CID 915288) has the molecular formula C16H14N2O2S
and a molecular weight of 298.37 g/mol. Its IUPAC name is S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate.
Molecular Properties
| Compound Name | S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate |
| PubChem CID | 915288 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate |
| SMILES | O=C(CN[C@H]1C(=O)Nc2ccccc21)Sc1ccccc1 |
| InChI | InChI=1S/C16H14N2O2S/c19-14(21-11-6-2-1-3-7-11)10-17-15-12-8-4-5-9-13(12)18-16(15)20/h1-9,15,17H,10H2,(H,18,20)/t15-/m1/s1 |
| InChIKey | RXWHDAJZYUBKGZ-OAHLLOKOSA-N |
| XLogP | 2.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate?
The IUPAC name of S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate (CID 915288) is S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate.
What is the SMILES notation for S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate?
The canonical SMILES for S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate is O=C(CN[C@H]1C(=O)Nc2ccccc21)Sc1ccccc1.
What is the InChIKey of S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate?
The InChIKey is RXWHDAJZYUBKGZ-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H14N2O2S/c19-14(21-11-6-2-1-3-7-11)10-17-15-12-8-4-5-9-13(12)18-16(15)20/h1-9,15,17H,10H2,(H,18,20)/t15-/m1/s1.
What are the key properties of S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate?
S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate has a molecular weight of 298.37 g/mol, XLogP of 2.59, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl 2-[[(3R)-2-oxo-1,3-dihydroindol-3-yl]amino]ethanethioate is sourced from PubChem (CID 915288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).