C24H20N4O8S — CID 91528901
4,11-diamino-2-[2-[2-(2,5-dihydroxypyrrol-1-yl)ethylsulfonyl]ethyl]naphtho[2,3-f]isoindole-1,3,5,10-tetrone (PubChem CID 91528901) has the molecular formula C24H20N4O8S and a molecular weight of 524.51 g/mol. Its IUPAC name is 4,11-diamino-2-[2-[2-(2,5-dihydroxypyrrol-1-yl)ethylsulfonyl]ethyl]naphtho[2,3-f]isoindole-1,3,5,10-tetrone.
| Compound Name | 4,11-diamino-2-[2-[2-(2,5-dihydroxypyrrol-1-yl)ethylsulfonyl]ethyl]naphtho[2,3-f]isoindole-1,3,5,10-tetrone |
|---|---|
| PubChem CID | 91528901 |
| Molecular Formula | C24H20N4O8S |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | 4,11-diamino-2-[2-[2-(2,5-dihydroxypyrrol-1-yl)ethylsulfonyl]ethyl]naphtho[2,3-f]isoindole-1,3,5,10-tetrone |
| SMILES | Nc1c2c(=O)c3ccccc3c(=O)c2c(N)c2c(=O)n(CCS(=O)(=O)CCn3c(O)ccc3O)c(=O)c12 |
| InChI | InChI=1S/C24H20N4O8S/c25-19-15-16(22(32)12-4-2-1-3-11(12)21(15)31)20(26)18-17(19)23(33)28(24(18)34)8-10-37(35,36)9-7-27-13(29)5-6-14(27)30/h1-6,29-30H,7-10,25-26H2 |
| InChIKey | AUJODJIDYBQQRE-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 204.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|