C33H55O10P — CID 91528902
[2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] [2,5,7,8-tetramethyl-2-(4-methylpentyl)-3,4-dihydrochromen-6-yl] hydrogen phosphate;octane (PubChem CID 91528902) has the molecular formula C33H55O10P and a molecular weight of 642.77 g/mol. Its IUPAC name is [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] [2,5,7,8-tetramethyl-2-(4-methylpentyl)-3,4-dihydrochromen-6-yl] hydrogen phosphate;octane.
| Compound Name | [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] [2,5,7,8-tetramethyl-2-(4-methylpentyl)-3,4-dihydrochromen-6-yl] hydrogen phosphate;octane |
|---|---|
| PubChem CID | 91528902 |
| Molecular Formula | C33H55O10P |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | [2-(1,2-dihydroxyethyl)-3-hydroxy-5-oxo-2H-furan-4-yl] [2,5,7,8-tetramethyl-2-(4-methylpentyl)-3,4-dihydrochromen-6-yl] hydrogen phosphate;octane |
| SMILES | CCCCCCCC.Cc1c(C)c2c(c(C)c1OP(=O)(O)OC1=C(O)C(C(O)CO)OC1=O)CCC(C)(CCCC(C)C)O2 |
| InChI | InChI=1S/C25H37O10P.C8H18/c1-13(2)8-7-10-25(6)11-9-17-16(5)20(14(3)15(4)21(17)33-25)34-36(30,31)35-23-19(28)22(18(27)12-26)32-24(23)29;1-3-5-7-8-6-4-2/h13,18,22,26-28H,7-12H2,1-6H3,(H,30,31);3-8H2,1-2H3 |
| InChIKey | FSQLPIBSPODKPP-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|