C23H31NO6 — CID 91529077
tert-butyl 2-[[6-(3-methoxypropyl)-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl]amino]acetate (PubChem CID 91529077) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is tert-butyl 2-[[6-(3-methoxypropyl)-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl]amino]acetate.
| Compound Name | tert-butyl 2-[[6-(3-methoxypropyl)-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 91529077 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | tert-butyl 2-[[6-(3-methoxypropyl)-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl]amino]acetate |
| SMILES | COCCCc1ccc2c(c1)C(C)(C)C(=O)C(C(=O)NCC(=O)OC(C)(C)C)C2=O |
| InChI | InChI=1S/C23H31NO6/c1-22(2,3)30-17(25)13-24-21(28)18-19(26)15-10-9-14(8-7-11-29-6)12-16(15)23(4,5)20(18)27/h9-10,12,18H,7-8,11,13H2,1-6H3,(H,24,28) |
| InChIKey | LNQJHWZPDQICGC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|