C13H18 — CID 91529219
2,4a,4b,7,8,8a,9,9a-octahydro-1H-fluorene (PubChem CID 91529219) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 2,4a,4b,7,8,8a,9,9a-octahydro-1H-fluorene.
| Compound Name | 2,4a,4b,7,8,8a,9,9a-octahydro-1H-fluorene |
|---|---|
| PubChem CID | 91529219 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2,4a,4b,7,8,8a,9,9a-octahydro-1H-fluorene |
| SMILES | C1=CC2C(CC1)CC1CCC=CC12 |
| InChI | InChI=1S/C13H18/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h3-4,7-8,10-13H,1-2,5-6,9H2 |
| InChIKey | MJEMJRURDSSLMK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|