C24H30ClN3O2 — CID 9152960
4-chloro-N-[(2R)-4-methyl-1-[4-(2-methylphenyl)piperazin-1-yl]-1-oxopentan-2-yl]benzamide (PubChem CID 9152960) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-4-methyl-1-[4-(2-methylphenyl)piperazin-1-yl]-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[(2R)-4-methyl-1-[4-(2-methylphenyl)piperazin-1-yl]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 9152960 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 4-chloro-N-[(2R)-4-methyl-1-[4-(2-methylphenyl)piperazin-1-yl]-1-oxopentan-2-yl]benzamide |
| SMILES | Cc1ccccc1N1CCN(C(=O)[C@@H](CC(C)C)NC(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H30ClN3O2/c1-17(2)16-21(26-23(29)19-8-10-20(25)11-9-19)24(30)28-14-12-27(13-15-28)22-7-5-4-6-18(22)3/h4-11,17,21H,12-16H2,1-3H3,(H,26,29)/t21-/m1/s1 |
| InChIKey | HBUODRGFSOKAQA-OAQYLSRUSA-N |
| XLogP | 4.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |