C29H42O6 — CID 91529605
(1R,9S,10S,12S,16S,19R,20R,21S,22R)-9,21-dihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-5,7,14-triene-3,4-dione (PubChem CID 91529605) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is (1R,9S,10S,12S,16S,19R,20R,21S,22R)-9,21-dihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-5,7,14-triene-3,4-dione.
| Compound Name | (1R,9S,10S,12S,16S,19R,20R,21S,22R)-9,21-dihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-5,7,14-triene-3,4-dione |
|---|---|
| PubChem CID | 91529605 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (1R,9S,10S,12S,16S,19R,20R,21S,22R)-9,21-dihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.16,9.02,7]tetracosa-5,7,14-triene-3,4-dione |
| SMILES | CC1=C[C@@H](C)CC[C@H]2O[C@@H](C3C(=O)C(=O)C(C)=C4O[C@](O)(C=C43)[C@@H](C)C[C@H](C)C1)[C@H](C)[C@@H](O)[C@H]2C |
| InChI | InChI=1S/C29H42O6/c1-14-8-9-22-18(5)24(30)19(6)28(34-22)23-21-13-29(33,17(4)12-16(3)11-15(2)10-14)35-27(21)20(7)25(31)26(23)32/h10,13-14,16-19,22-24,28,30,33H,8-9,11-12H2,1-7H3/t14-,16+,17-,18-,19+,22+,23?,24-,28+,29+/m0/s1 |
| InChIKey | OPRMEAXDCSIVJB-OCZFOLMRSA-N |
| XLogP | 4.50 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|