About (E)-pent-3-en-2-imine
(E)-pent-3-en-2-imine (PubChem CID 91530034) has the molecular formula C5H9N
and a molecular weight of 83.13 g/mol. Its IUPAC name is (E)-pent-3-en-2-imine.
Molecular Properties
| Compound Name | (E)-pent-3-en-2-imine |
| PubChem CID | 91530034 |
| Molecular Formula | C5H9N |
| Molecular Weight | 83.13 g/mol |
| Exact Mass | 83.07 |
| IUPAC Name | (E)-pent-3-en-2-imine |
| SMILES | [H]/N=C(C)/C=C/C |
| InChI | InChI=1S/C5H9N/c1-3-4-5(2)6/h3-4,6H,1-2H3/b4-3+,6-5+ |
| InChIKey | XHNNGOGLLILASH-VNKDHWASSA-N |
| XLogP | 1.60 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.13 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-pent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-pent-3-en-2-imine?
The IUPAC name of (E)-pent-3-en-2-imine (CID 91530034) is (E)-pent-3-en-2-imine.
What is the SMILES notation for (E)-pent-3-en-2-imine?
The canonical SMILES for (E)-pent-3-en-2-imine is [H]/N=C(C)/C=C/C.
What is the InChIKey of (E)-pent-3-en-2-imine?
The InChIKey is XHNNGOGLLILASH-VNKDHWASSA-N. The full InChI is InChI=1S/C5H9N/c1-3-4-5(2)6/h3-4,6H,1-2H3/b4-3+,6-5+.
What are the key properties of (E)-pent-3-en-2-imine?
(E)-pent-3-en-2-imine has a molecular weight of 83.13 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-pent-3-en-2-imine is sourced from PubChem (CID 91530034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).