About (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran
(3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran (PubChem CID 91530448) has the molecular formula C6H9FO
and a molecular weight of 116.13 g/mol. Its IUPAC name is (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran |
| PubChem CID | 91530448 |
| Molecular Formula | C6H9FO |
| Molecular Weight | 116.13 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran |
| SMILES | C[C@H]1C=C[C@H](F)CO1 |
| InChI | InChI=1S/C6H9FO/c1-5-2-3-6(7)4-8-5/h2-3,5-6H,4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | ZOKOUHKGAPGSCB-WDSKDSINSA-N |
| XLogP | 1.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.13 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran?
The IUPAC name of (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran (CID 91530448) is (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran?
The canonical SMILES for (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran is C[C@H]1C=C[C@H](F)CO1.
What is the InChIKey of (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran?
The InChIKey is ZOKOUHKGAPGSCB-WDSKDSINSA-N. The full InChI is InChI=1S/C6H9FO/c1-5-2-3-6(7)4-8-5/h2-3,5-6H,4H2,1H3/t5-,6-/m0/s1.
What are the key properties of (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran?
(3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran has a molecular weight of 116.13 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6S)-3-fluoro-6-methyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 91530448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).