C27H48O2 — CID 91530695
1-[1-(3,7-dimethylocta-2,6-dienoxy)heptoxy]-3,7-dimethylocta-2,6-diene (PubChem CID 91530695) has the molecular formula C27H48O2 and a molecular weight of 404.68 g/mol. Its IUPAC name is 1-[1-(3,7-dimethylocta-2,6-dienoxy)heptoxy]-3,7-dimethylocta-2,6-diene.
| Compound Name | 1-[1-(3,7-dimethylocta-2,6-dienoxy)heptoxy]-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 91530695 |
| Molecular Formula | C27H48O2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.37 |
| IUPAC Name | 1-[1-(3,7-dimethylocta-2,6-dienoxy)heptoxy]-3,7-dimethylocta-2,6-diene |
| SMILES | CCCCCCC(OCC=C(C)CCC=C(C)C)OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C27H48O2/c1-8-9-10-11-18-27(28-21-19-25(6)16-12-14-23(2)3)29-22-20-26(7)17-13-15-24(4)5/h14-15,19-20,27H,8-13,16-18,21-22H2,1-7H3 |
| InChIKey | DYWVNHJREMANPE-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|