About 3,5-dihydro-2H-indazole
3,5-dihydro-2H-indazole (PubChem CID 91531332) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 3,5-dihydro-2H-indazole.
Molecular Properties
| Compound Name | 3,5-dihydro-2H-indazole |
| PubChem CID | 91531332 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 3,5-dihydro-2H-indazole |
| SMILES | C1=CC2=NNCC2=CC1 |
| InChI | InChI=1S/C7H8N2/c1-2-4-7-6(3-1)5-8-9-7/h2-4,8H,1,5H2 |
| InChIKey | GSARVVHCIWDYHB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dihydro-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydro-2H-indazole?
The IUPAC name of 3,5-dihydro-2H-indazole (CID 91531332) is 3,5-dihydro-2H-indazole.
What is the SMILES notation for 3,5-dihydro-2H-indazole?
The canonical SMILES for 3,5-dihydro-2H-indazole is C1=CC2=NNCC2=CC1.
What is the InChIKey of 3,5-dihydro-2H-indazole?
The InChIKey is GSARVVHCIWDYHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-2-4-7-6(3-1)5-8-9-7/h2-4,8H,1,5H2.
What are the key properties of 3,5-dihydro-2H-indazole?
3,5-dihydro-2H-indazole has a molecular weight of 120.15 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydro-2H-indazole is sourced from PubChem (CID 91531332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).