C30H36N2O4 — CID 91531655
ethane;3-(1-methylindol-3-yl)-2-[(4-phenylphenyl)methoxycarbonylamino]propanoic acid (PubChem CID 91531655) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is ethane;3-(1-methylindol-3-yl)-2-[(4-phenylphenyl)methoxycarbonylamino]propanoic acid.
| Compound Name | ethane;3-(1-methylindol-3-yl)-2-[(4-phenylphenyl)methoxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 91531655 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | ethane;3-(1-methylindol-3-yl)-2-[(4-phenylphenyl)methoxycarbonylamino]propanoic acid |
| SMILES | CC.CC.Cn1cc(CC(NC(=O)OCc2ccc(-c3ccccc3)cc2)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C26H24N2O4.2C2H6/c1-28-16-21(22-9-5-6-10-24(22)28)15-23(25(29)30)27-26(31)32-17-18-11-13-20(14-12-18)19-7-3-2-4-8-19;2*1-2/h2-14,16,23H,15,17H2,1H3,(H,27,31)(H,29,30);2*1-2H3 |
| InChIKey | JEVYICSZKDQLFE-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |