C24H29N3O2S — CID 9153194
2-[2-[4-(2-methylphenyl)piperazine-1-carbonyl]phenyl]sulfanyl-1-pyrrolidin-1-ylethanone (PubChem CID 9153194) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-[2-[4-(2-methylphenyl)piperazine-1-carbonyl]phenyl]sulfanyl-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[2-[4-(2-methylphenyl)piperazine-1-carbonyl]phenyl]sulfanyl-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 9153194 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[2-[4-(2-methylphenyl)piperazine-1-carbonyl]phenyl]sulfanyl-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1ccccc1N1CCN(C(=O)c2ccccc2SCC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C24H29N3O2S/c1-19-8-2-4-10-21(19)25-14-16-27(17-15-25)24(29)20-9-3-5-11-22(20)30-18-23(28)26-12-6-7-13-26/h2-5,8-11H,6-7,12-18H2,1H3 |
| InChIKey | GSLTXVOVMILIRP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |