About 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid
2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid (PubChem CID 91531991) has the molecular formula C16H15BrO6
and a molecular weight of 383.19 g/mol. Its IUPAC name is 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid |
| PubChem CID | 91531991 |
| Molecular Formula | C16H15BrO6 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid |
| SMILES | CC(=O)CCc1ccc(-c2c(O)cc(O)c(Br)c2CC(=O)O)o1 |
| InChI | InChI=1S/C16H15BrO6/c1-8(18)2-3-9-4-5-13(23-9)15-10(6-14(21)22)16(17)12(20)7-11(15)19/h4-5,7,19-20H,2-3,6H2,1H3,(H,21,22) |
| InChIKey | MCYKBNCULSPGIE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid?
The IUPAC name of 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid (CID 91531991) is 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid.
What is the SMILES notation for 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid?
The canonical SMILES for 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid is CC(=O)CCc1ccc(-c2c(O)cc(O)c(Br)c2CC(=O)O)o1.
What is the InChIKey of 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid?
The InChIKey is MCYKBNCULSPGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrO6/c1-8(18)2-3-9-4-5-13(23-9)15-10(6-14(21)22)16(17)12(20)7-11(15)19/h4-5,7,19-20H,2-3,6H2,1H3,(H,21,22).
What are the key properties of 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid?
2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid has a molecular weight of 383.19 g/mol, XLogP of 3.27, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bromo-3,5-dihydroxy-6-[5-(3-oxobutyl)furan-2-yl]phenyl]acetic acid is sourced from PubChem (CID 91531991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).