C27H50N2O7 — CID 91532391
4-[[3-[3-carboxypropanoyl(octyl)amino]-2-hydroxypropyl]-octylamino]-4-oxobutanoic acid (PubChem CID 91532391) has the molecular formula C27H50N2O7 and a molecular weight of 514.70 g/mol. Its IUPAC name is 4-[[3-[3-carboxypropanoyl(octyl)amino]-2-hydroxypropyl]-octylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-[3-carboxypropanoyl(octyl)amino]-2-hydroxypropyl]-octylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91532391 |
| Molecular Formula | C27H50N2O7 |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | 4-[[3-[3-carboxypropanoyl(octyl)amino]-2-hydroxypropyl]-octylamino]-4-oxobutanoic acid |
| SMILES | CCCCCCCCN(CC(O)CN(CCCCCCCC)C(=O)CCC(=O)O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C27H50N2O7/c1-3-5-7-9-11-13-19-28(24(31)15-17-26(33)34)21-23(30)22-29(25(32)16-18-27(35)36)20-14-12-10-8-6-4-2/h23,30H,3-22H2,1-2H3,(H,33,34)(H,35,36) |
| InChIKey | GSZLVDYFKWOAJE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|