(1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride

C10H14Cl2O2 — CID 91532547

IUPAC(1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride
SMILESCC1(C)C(C(=O)Cl)CC[C@@]1(C)C(=O)Cl
InChIInChI=1S/C10H14Cl2O2/c1-9(2)6(7(11)13)4-5-10(9,3)8(12)14/h6H,4-5H2,1-3H3/t6?,10-/m0/s1
InChIKeyJEIWMMMVZOQQHT-TYICEKJOSA-N
MW237.13 g/mol
LogP2.96
Rot. Bonds2

About (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride

(1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride (PubChem CID 91532547) has the molecular formula C10H14Cl2O2 and a molecular weight of 237.13 g/mol. Its IUPAC name is (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride.

Molecular Properties

Compound Name(1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride
PubChem CID91532547
Molecular FormulaC10H14Cl2O2
Molecular Weight237.13 g/mol
Exact Mass236.04
IUPAC Name(1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride
SMILESCC1(C)C(C(=O)Cl)CC[C@@]1(C)C(=O)Cl
InChIInChI=1S/C10H14Cl2O2/c1-9(2)6(7(11)13)4-5-10(9,3)8(12)14/h6H,4-5H2,1-3H3/t6?,10-/m0/s1
InChIKeyJEIWMMMVZOQQHT-TYICEKJOSA-N
XLogP2.96
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.13
LogP ≤ 52.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride?
The IUPAC name of (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride (CID 91532547) is (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride.
What is the SMILES notation for (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride?
The canonical SMILES for (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride is CC1(C)C(C(=O)Cl)CC[C@@]1(C)C(=O)Cl.
What is the InChIKey of (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride?
The InChIKey is JEIWMMMVZOQQHT-TYICEKJOSA-N. The full InChI is InChI=1S/C10H14Cl2O2/c1-9(2)6(7(11)13)4-5-10(9,3)8(12)14/h6H,4-5H2,1-3H3/t6?,10-/m0/s1.
What are the key properties of (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride?
(1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride has a molecular weight of 237.13 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1,2,2-trimethylcyclopentane-1,3-dicarbonyl chloride is sourced from PubChem (CID 91532547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).