About CID 91533043
CID 91533043 (PubChem CID 91533043) has the molecular formula C10H12BNO
and a molecular weight of 173.02 g/mol.
Molecular Properties
| Compound Name | CID 91533043 |
| PubChem CID | 91533043 |
| Molecular Formula | C10H12BNO |
| Molecular Weight | 173.02 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | — |
| SMILES | [B]c1c(C)c(O)cc(C(=C)C)c1N |
| InChI | InChI=1S/C10H12BNO/c1-5(2)7-4-8(13)6(3)9(11)10(7)12/h4,13H,1,12H2,2-3H3 |
| InChIKey | WONXYYNQHAETSL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.02 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 91533043 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91533043?
The IUPAC name of CID 91533043 (CID 91533043) is not available.
What is the SMILES notation for CID 91533043?
The canonical SMILES for CID 91533043 is [B]c1c(C)c(O)cc(C(=C)C)c1N.
What is the InChIKey of CID 91533043?
The InChIKey is WONXYYNQHAETSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BNO/c1-5(2)7-4-8(13)6(3)9(11)10(7)12/h4,13H,1,12H2,2-3H3.
What are the key properties of CID 91533043?
CID 91533043 has a molecular weight of 173.02 g/mol, XLogP of 1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91533043 is sourced from PubChem (CID 91533043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).