C10H19N3O4 — CID 91533089
2-amino-N-(2-hydroxy-4-oxopentan-3-yl)pentanediamide (PubChem CID 91533089) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-4-oxopentan-3-yl)pentanediamide.
| Compound Name | 2-amino-N-(2-hydroxy-4-oxopentan-3-yl)pentanediamide |
|---|---|
| PubChem CID | 91533089 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-amino-N-(2-hydroxy-4-oxopentan-3-yl)pentanediamide |
| SMILES | CC(=O)C(NC(=O)C(N)CCC(N)=O)C(C)O |
| InChI | InChI=1S/C10H19N3O4/c1-5(14)9(6(2)15)13-10(17)7(11)3-4-8(12)16/h5,7,9,14H,3-4,11H2,1-2H3,(H2,12,16)(H,13,17) |
| InChIKey | MQXXYEIQBJUSLS-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |