About 2-propoxyoctanedial
2-propoxyoctanedial (PubChem CID 91533192) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-propoxyoctanedial.
Molecular Properties
| Compound Name | 2-propoxyoctanedial |
| PubChem CID | 91533192 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-propoxyoctanedial |
| SMILES | CCCOC(C=O)CCCCCC=O |
| InChI | InChI=1S/C11H20O3/c1-2-9-14-11(10-13)7-5-3-4-6-8-12/h8,10-11H,2-7,9H2,1H3 |
| InChIKey | LKSAOKOGWHSWRE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propoxyoctanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxyoctanedial?
The IUPAC name of 2-propoxyoctanedial (CID 91533192) is 2-propoxyoctanedial.
What is the SMILES notation for 2-propoxyoctanedial?
The canonical SMILES for 2-propoxyoctanedial is CCCOC(C=O)CCCCCC=O.
What is the InChIKey of 2-propoxyoctanedial?
The InChIKey is LKSAOKOGWHSWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-2-9-14-11(10-13)7-5-3-4-6-8-12/h8,10-11H,2-7,9H2,1H3.
What are the key properties of 2-propoxyoctanedial?
2-propoxyoctanedial has a molecular weight of 200.28 g/mol, XLogP of 2.13, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxyoctanedial is sourced from PubChem (CID 91533192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).