C8H10F3NO4S — CID 91533202
N-(1,3-diformyl-2,2-dimethylcyclopropyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 91533202) has the molecular formula C8H10F3NO4S and a molecular weight of 273.23 g/mol. Its IUPAC name is N-(1,3-diformyl-2,2-dimethylcyclopropyl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(1,3-diformyl-2,2-dimethylcyclopropyl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 91533202 |
| Molecular Formula | C8H10F3NO4S |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | N-(1,3-diformyl-2,2-dimethylcyclopropyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC1(C)C(C=O)C1(C=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO4S/c1-6(2)5(3-13)7(6,4-14)12-17(15,16)8(9,10)11/h3-5,12H,1-2H3 |
| InChIKey | SWTRFUBBWXBQJR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|