C22H37NO7 — CID 91533219
(2,6-dimethoxy-4-methylphenyl) 2-[bis(2-ethoxyethyl)amino]-4-methoxybutanoate (PubChem CID 91533219) has the molecular formula C22H37NO7 and a molecular weight of 427.54 g/mol. Its IUPAC name is (2,6-dimethoxy-4-methylphenyl) 2-[bis(2-ethoxyethyl)amino]-4-methoxybutanoate.
| Compound Name | (2,6-dimethoxy-4-methylphenyl) 2-[bis(2-ethoxyethyl)amino]-4-methoxybutanoate |
|---|---|
| PubChem CID | 91533219 |
| Molecular Formula | C22H37NO7 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (2,6-dimethoxy-4-methylphenyl) 2-[bis(2-ethoxyethyl)amino]-4-methoxybutanoate |
| SMILES | CCOCCN(CCOCC)C(CCOC)C(=O)Oc1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C22H37NO7/c1-7-28-13-10-23(11-14-29-8-2)18(9-12-25-4)22(24)30-21-19(26-5)15-17(3)16-20(21)27-6/h15-16,18H,7-14H2,1-6H3 |
| InChIKey | CFLXSBRZUOMUDD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|