C14H18F2N2 — CID 91533250
2-(4,4-difluoropiperidin-1-yl)-N-methyl-2-phenylethanimine (PubChem CID 91533250) has the molecular formula C14H18F2N2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-N-methyl-2-phenylethanimine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-N-methyl-2-phenylethanimine |
|---|---|
| PubChem CID | 91533250 |
| Molecular Formula | C14H18F2N2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-N-methyl-2-phenylethanimine |
| SMILES | C/N=C/C(c1ccccc1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H18F2N2/c1-17-11-13(12-5-3-2-4-6-12)18-9-7-14(15,16)8-10-18/h2-6,11,13H,7-10H2,1H3/b17-11+ |
| InChIKey | NSVHPIVCXYYMKI-GZTJUZNOSA-N |
| XLogP | 3.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|