About cyclopenta[d]thiazine
cyclopenta[d]thiazine (PubChem CID 91533308) has the molecular formula C7H5NS
and a molecular weight of 135.19 g/mol. Its IUPAC name is cyclopenta[d]thiazine.
Molecular Properties
| Compound Name | cyclopenta[d]thiazine |
| PubChem CID | 91533308 |
| Molecular Formula | C7H5NS |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | cyclopenta[d]thiazine |
| SMILES | c1cc2cnscc-2c1 |
| InChI | InChI=1S/C7H5NS/c1-2-6-4-8-9-5-7(6)3-1/h1-5H |
| InChIKey | FJROUDCKSVIHLO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta[d]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[d]thiazine?
The IUPAC name of cyclopenta[d]thiazine (CID 91533308) is cyclopenta[d]thiazine.
What is the SMILES notation for cyclopenta[d]thiazine?
The canonical SMILES for cyclopenta[d]thiazine is c1cc2cnscc-2c1.
What is the InChIKey of cyclopenta[d]thiazine?
The InChIKey is FJROUDCKSVIHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS/c1-2-6-4-8-9-5-7(6)3-1/h1-5H.
What are the key properties of cyclopenta[d]thiazine?
cyclopenta[d]thiazine has a molecular weight of 135.19 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[d]thiazine is sourced from PubChem (CID 91533308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).