C24H20FN3O7 — CID 91533314
(4aS,5aR,12aS)-9-amino-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91533314) has the molecular formula C24H20FN3O7 and a molecular weight of 481.44 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-amino-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-amino-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91533314 |
| Molecular Formula | C24H20FN3O7 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (4aS,5aR,12aS)-9-amino-7-(6-fluoro-3-pyridinyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(-c5ccc(F)nc5)cc(N)c(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C24H20FN3O7/c25-15-2-1-8(7-28-15)11-6-13(26)19(30)17-12(11)4-9-3-10-5-14(29)18(23(27)34)22(33)24(10,35)21(32)16(9)20(17)31/h1-2,6-7,9-10,16,18,30,35H,3-5,26H2,(H2,27,34)/t9-,10+,16?,18?,24+/m1/s1 |
| InChIKey | UVKGNODPIFCAEV-NWXRYVOFSA-N |
| XLogP | 0.11 |
| TPSA | 190.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|