C10H4F14O — CID 91533350
3,4,4,4-tetrafluoro-1-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)but-1-enoxy]-3-(trifluoromethyl)but-1-ene (PubChem CID 91533350) has the molecular formula C10H4F14O and a molecular weight of 406.11 g/mol. Its IUPAC name is 3,4,4,4-tetrafluoro-1-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)but-1-enoxy]-3-(trifluoromethyl)but-1-ene.
| Compound Name | 3,4,4,4-tetrafluoro-1-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)but-1-enoxy]-3-(trifluoromethyl)but-1-ene |
|---|---|
| PubChem CID | 91533350 |
| Molecular Formula | C10H4F14O |
| Molecular Weight | 406.11 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 3,4,4,4-tetrafluoro-1-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)but-1-enoxy]-3-(trifluoromethyl)but-1-ene |
| SMILES | FC(F)(F)C(F)(C=COC=CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F14O/c11-5(7(13,14)15,8(16,17)18)1-3-25-4-2-6(12,9(19,20)21)10(22,23)24/h1-4H |
| InChIKey | RWMDGMFCUUZFFM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.11 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|