C12H14O3 — CID 91533541
2,3-dimethoxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 91533541) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2,3-dimethoxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2,3-dimethoxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 91533541 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2,3-dimethoxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | COC1Cc2ccccc2C(=O)C1OC |
| InChI | InChI=1S/C12H14O3/c1-14-10-7-8-5-3-4-6-9(8)11(13)12(10)15-2/h3-6,10,12H,7H2,1-2H3 |
| InChIKey | ODGWWISRKZZSQV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |