About (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate
(2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate (PubChem CID 91533729) has the molecular formula C28H27NO5S2
and a molecular weight of 521.66 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate |
| PubChem CID | 91533729 |
| Molecular Formula | C28H27NO5S2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate |
| SMILES | CSc1ccc(C(O)(c2ccc(CCC(=O)On3c(O)ccc3O)cc2)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C28H27NO5S2/c1-35-23-12-8-21(9-13-23)28(33,22-10-14-24(36-2)15-11-22)20-6-3-19(4-7-20)5-18-27(32)34-29-25(30)16-17-26(29)31/h3-4,6-17,30-31,33H,5,18H2,1-2H3 |
| InChIKey | FODKIHCAFGEGTA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate (CID 91533729) is (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate is CSc1ccc(C(O)(c2ccc(CCC(=O)On3c(O)ccc3O)cc2)c2ccc(SC)cc2)cc1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate?
The InChIKey is FODKIHCAFGEGTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27NO5S2/c1-35-23-12-8-21(9-13-23)28(33,22-10-14-24(36-2)15-11-22)20-6-3-19(4-7-20)5-18-27(32)34-29-25(30)16-17-26(29)31/h3-4,6-17,30-31,33H,5,18H2,1-2H3.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate?
(2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate has a molecular weight of 521.66 g/mol, XLogP of 5.22, 9 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 3-[4-[hydroxy-bis(4-methylsulfanylphenyl)methyl]phenyl]propanoate is sourced from PubChem (CID 91533729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).