C13H25NO7 — CID 91533772
(2R,3S,5R)-2-[(Z,3S,4S,5R)-3-amino-4,5-dihydroxyhept-1-enyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 91533772) has the molecular formula C13H25NO7 and a molecular weight of 307.34 g/mol. Its IUPAC name is (2R,3S,5R)-2-[(Z,3S,4S,5R)-3-amino-4,5-dihydroxyhept-1-enyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,5R)-2-[(Z,3S,4S,5R)-3-amino-4,5-dihydroxyhept-1-enyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91533772 |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2R,3S,5R)-2-[(Z,3S,4S,5R)-3-amino-4,5-dihydroxyhept-1-enyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC[C@@H](O)[C@@H](O)[C@@H](N)/C=C\[C@H]1OC(CO)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C13H25NO7/c1-2-7(16)10(17)6(14)3-4-8-11(18)13(20)12(19)9(5-15)21-8/h3-4,6-13,15-20H,2,5,14H2,1H3/b4-3-/t6-,7+,8+,9?,10-,11+,12-,13?/m0/s1 |
| InChIKey | NDADBUWUHAFFSK-RUBHYWAVSA-N |
| XLogP | -3.16 |
| TPSA | 156.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|