C8H3FO6 — CID 91533794
1-fluoro-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 91533794) has the molecular formula C8H3FO6 and a molecular weight of 214.10 g/mol. Its IUPAC name is 1-fluoro-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 1-fluoro-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 91533794 |
| Molecular Formula | C8H3FO6 |
| Molecular Weight | 214.10 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 1-fluoro-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | O=C1OC(=O)C2C1C1C(=O)OC(=O)C21F |
| InChI | InChI=1S/C8H3FO6/c9-8-2-1(4(10)14-5(2)11)3(8)6(12)15-7(8)13/h1-3H |
| InChIKey | UVTGBRAKLBNLPB-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.10 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|