C27H41N3O3 — CID 91533879
(3aS,3bS,9aS,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide (PubChem CID 91533879) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is (3aS,3bS,9aS,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide.
| Compound Name | (3aS,3bS,9aS,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 91533879 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | (3aS,3bS,9aS,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
| SMILES | CN1C(=O)C(C(=O)NCCCN2CCCC2=O)=C[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C27H41N3O3/c1-26-12-4-7-20(26)18-9-10-22-27(2,21(18)11-13-26)17-19(25(33)29(22)3)24(32)28-14-6-16-30-15-5-8-23(30)31/h17-18,20-22H,4-16H2,1-3H3,(H,28,32)/t18-,20-,21+,22?,26-,27+/m0/s1 |
| InChIKey | SZTOCDVLDUOLKZ-WYVBAWDZSA-N |
| XLogP | 3.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|