About cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate
cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate (PubChem CID 91533901) has the molecular formula C19H28O3
and a molecular weight of 304.43 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate.
Molecular Properties
| Compound Name | cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate |
| PubChem CID | 91533901 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate |
| SMILES | C=CC(C)(C(C)C)C(CC(=O)OCC1=CC=CCC1)C(C)=O |
| InChI | InChI=1S/C19H28O3/c1-6-19(5,14(2)3)17(15(4)20)12-18(21)22-13-16-10-8-7-9-11-16/h6-8,10,14,17H,1,9,11-13H2,2-5H3 |
| InChIKey | HIWBFKQXDQHWLB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate?
The IUPAC name of cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate (CID 91533901) is cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate.
What is the SMILES notation for cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate?
The canonical SMILES for cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate is C=CC(C)(C(C)C)C(CC(=O)OCC1=CC=CCC1)C(C)=O.
What is the InChIKey of cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate?
The InChIKey is HIWBFKQXDQHWLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O3/c1-6-19(5,14(2)3)17(15(4)20)12-18(21)22-13-16-10-8-7-9-11-16/h6-8,10,14,17H,1,9,11-13H2,2-5H3.
What are the key properties of cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate?
cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate has a molecular weight of 304.43 g/mol, XLogP of 4.25, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-dien-1-ylmethyl 3-acetyl-4-methyl-4-propan-2-ylhex-5-enoate is sourced from PubChem (CID 91533901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).