C46H47F2N3O7S2 — CID 91534448
[2-[5-fluoro-2-methyl-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]indol-1-yl]acetyl] 2-[3-[(2-cyclopentylsulfonylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetate (PubChem CID 91534448) has the molecular formula C46H47F2N3O7S2 and a molecular weight of 856.03 g/mol. Its IUPAC name is [2-[5-fluoro-2-methyl-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]indol-1-yl]acetyl] 2-[3-[(2-cyclopentylsulfonylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetate.
| Compound Name | [2-[5-fluoro-2-methyl-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]indol-1-yl]acetyl] 2-[3-[(2-cyclopentylsulfonylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 91534448 |
| Molecular Formula | C46H47F2N3O7S2 |
| Molecular Weight | 856.03 g/mol |
| Exact Mass | 855.28 |
| IUPAC Name | [2-[5-fluoro-2-methyl-3-[(2-piperidin-1-ylsulfonylphenyl)methyl]indol-1-yl]acetyl] 2-[3-[(2-cyclopentylsulfonylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetate |
| SMILES | Cc1c(Cc2ccccc2S(=O)(=O)C2CCCC2)c2cc(F)ccc2n1CC(=O)OC(=O)Cn1c(C)c(Cc2ccccc2S(=O)(=O)N2CCCCC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C46H47F2N3O7S2/c1-30-37(24-32-12-4-8-16-43(32)59(54,55)36-14-6-7-15-36)39-26-34(47)18-20-41(39)50(30)28-45(52)58-46(53)29-51-31(2)38(40-27-35(48)19-21-42(40)51)25-33-13-5-9-17-44(33)60(56,57)49-22-10-3-11-23-49/h4-5,8-9,12-13,16-21,26-27,36H,3,6-7,10-11,14-15,22-25,28-29H2,1-2H3 |
| InChIKey | FSDYBLBBLKMGTJ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 124.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.03 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|