C19H32N6 — CID 91534491
2,2-dicyano-N-(2-piperidin-1-ylethyl)-N'-(3-piperidin-1-ylpropyl)ethanimidamide (PubChem CID 91534491) has the molecular formula C19H32N6 and a molecular weight of 344.51 g/mol. Its IUPAC name is 2,2-dicyano-N-(2-piperidin-1-ylethyl)-N'-(3-piperidin-1-ylpropyl)ethanimidamide.
| Compound Name | 2,2-dicyano-N-(2-piperidin-1-ylethyl)-N'-(3-piperidin-1-ylpropyl)ethanimidamide |
|---|---|
| PubChem CID | 91534491 |
| Molecular Formula | C19H32N6 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2,2-dicyano-N-(2-piperidin-1-ylethyl)-N'-(3-piperidin-1-ylpropyl)ethanimidamide |
| SMILES | N#CC(C#N)/C(=N\CCCN1CCCCC1)NCCN1CCCCC1 |
| InChI | InChI=1S/C19H32N6/c20-16-18(17-21)19(23-9-15-25-12-5-2-6-13-25)22-8-7-14-24-10-3-1-4-11-24/h18H,1-15H2,(H,22,23) |
| InChIKey | AKOOJMXZUKYECO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|