C23H21ClFN9O — CID 91534544
N-[3-chloro-4-(1H-pyrazol-4-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine (PubChem CID 91534544) has the molecular formula C23H21ClFN9O and a molecular weight of 493.93 g/mol. Its IUPAC name is N-[3-chloro-4-(1H-pyrazol-4-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine.
| Compound Name | N-[3-chloro-4-(1H-pyrazol-4-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 91534544 |
| Molecular Formula | C23H21ClFN9O |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-[3-chloro-4-(1H-pyrazol-4-yl)phenyl]-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]pyridin-3-amine |
| SMILES | Fc1cnc(/N=N/Cc2ccc(Nc3ccc(-c4cn[nH]c4)c(Cl)c3)cn2)nc1N1CCOCC1 |
| InChI | InChI=1S/C23H21ClFN9O/c24-20-9-16(3-4-19(20)15-10-28-29-11-15)31-18-2-1-17(26-12-18)13-30-33-23-27-14-21(25)22(32-23)34-5-7-35-8-6-34/h1-4,9-12,14,31H,5-8,13H2,(H,28,29)/b33-30+ |
| InChIKey | UNDHBRBZZKLHAJ-KKYHWDRJSA-N |
| XLogP | 4.92 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|