About 1,3,5-trimethoxycyclohexa-1,4-diene
1,3,5-trimethoxycyclohexa-1,4-diene (PubChem CID 91534566) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1,3,5-trimethoxycyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1,3,5-trimethoxycyclohexa-1,4-diene |
| PubChem CID | 91534566 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1,3,5-trimethoxycyclohexa-1,4-diene |
| SMILES | COC1=CC(OC)C=C(OC)C1 |
| InChI | InChI=1S/C9H14O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-5,7H,6H2,1-3H3 |
| InChIKey | RWTZRGZUCLSOQA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3,5-trimethoxycyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trimethoxycyclohexa-1,4-diene?
The IUPAC name of 1,3,5-trimethoxycyclohexa-1,4-diene (CID 91534566) is 1,3,5-trimethoxycyclohexa-1,4-diene.
What is the SMILES notation for 1,3,5-trimethoxycyclohexa-1,4-diene?
The canonical SMILES for 1,3,5-trimethoxycyclohexa-1,4-diene is COC1=CC(OC)C=C(OC)C1.
What is the InChIKey of 1,3,5-trimethoxycyclohexa-1,4-diene?
The InChIKey is RWTZRGZUCLSOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-5,7H,6H2,1-3H3.
What are the key properties of 1,3,5-trimethoxycyclohexa-1,4-diene?
1,3,5-trimethoxycyclohexa-1,4-diene has a molecular weight of 170.21 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trimethoxycyclohexa-1,4-diene is sourced from PubChem (CID 91534566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).