C21H16N2O4 — CID 91534823
2,3,4-trihydroxy-N-[2-(1H-indol-2-yl)phenyl]benzamide (PubChem CID 91534823) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2,3,4-trihydroxy-N-[2-(1H-indol-2-yl)phenyl]benzamide.
| Compound Name | 2,3,4-trihydroxy-N-[2-(1H-indol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 91534823 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2,3,4-trihydroxy-N-[2-(1H-indol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1cc2ccccc2[nH]1)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C21H16N2O4/c24-18-10-9-14(19(25)20(18)26)21(27)23-16-8-4-2-6-13(16)17-11-12-5-1-3-7-15(12)22-17/h1-11,22,24-26H,(H,23,27) |
| InChIKey | OIONZVHFBPOTQI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|