About 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride
5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride (PubChem CID 91534940) has the molecular formula C5H6Cl2N2O2S
and a molecular weight of 229.09 g/mol. Its IUPAC name is 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride |
| PubChem CID | 91534940 |
| Molecular Formula | C5H6Cl2N2O2S |
| Molecular Weight | 229.09 g/mol |
| Exact Mass | 227.95 |
| IUPAC Name | 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride |
| SMILES | Cc1nc(S(=O)(=O)Cl)c(Cl)n1C |
| InChI | InChI=1S/C5H6Cl2N2O2S/c1-3-8-5(12(7,10)11)4(6)9(3)2/h1-2H3 |
| InChIKey | LIFMJBDANATILD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.09 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride?
The IUPAC name of 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride (CID 91534940) is 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride.
What is the SMILES notation for 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride?
The canonical SMILES for 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride is Cc1nc(S(=O)(=O)Cl)c(Cl)n1C.
What is the InChIKey of 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride?
The InChIKey is LIFMJBDANATILD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Cl2N2O2S/c1-3-8-5(12(7,10)11)4(6)9(3)2/h1-2H3.
What are the key properties of 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride?
5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride has a molecular weight of 229.09 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,2-dimethylimidazole-4-sulfonyl chloride is sourced from PubChem (CID 91534940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).