C18H23NO12 — CID 91535276
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,5-dihydroxypyrrol-1-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 91535276) has the molecular formula C18H23NO12 and a molecular weight of 445.38 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,5-dihydroxypyrrol-1-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,5-dihydroxypyrrol-1-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91535276 |
| Molecular Formula | C18H23NO12 |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2,5-dihydroxypyrrol-1-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](On2c(O)ccc2O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H23NO12/c1-8(20)26-7-12-15(27-9(2)21)16(28-10(3)22)17(29-11(4)23)18(30-12)31-19-13(24)5-6-14(19)25/h5-6,12,15-18,24-25H,7H2,1-4H3/t12-,15-,16+,17-,18+/m1/s1 |
| InChIKey | XXDOAHLZRIXTIX-CUWKQTPXSA-N |
| XLogP | -0.59 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|