C18H26N6O3S — CID 91535323
1-[[4-[[(5-ethylthiophen-2-yl)diazenyl]methyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]oxy]-2-methylpropan-2-ol (PubChem CID 91535323) has the molecular formula C18H26N6O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-[[4-[[(5-ethylthiophen-2-yl)diazenyl]methyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]oxy]-2-methylpropan-2-ol.
| Compound Name | 1-[[4-[[(5-ethylthiophen-2-yl)diazenyl]methyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]oxy]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 91535323 |
| Molecular Formula | C18H26N6O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-[[4-[[(5-ethylthiophen-2-yl)diazenyl]methyl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]oxy]-2-methylpropan-2-ol |
| SMILES | CCc1ccc(/N=N/Cc2nc(OCC(C)(C)O)nc(N3CCOCC3)n2)s1 |
| InChI | InChI=1S/C18H26N6O3S/c1-4-13-5-6-15(28-13)23-19-11-14-20-16(24-7-9-26-10-8-24)22-17(21-14)27-12-18(2,3)25/h5-6,25H,4,7-12H2,1-3H3/b23-19+ |
| InChIKey | HKHLYYSYDFZAIB-FCDQGJHFSA-N |
| XLogP | 2.77 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|